C22H30N2O3 — CID 4201930
1-[(2-methylphenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 4201930) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(2-methylphenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2-methylphenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4201930 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[(2-methylphenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cc(OC)c(C(c2ccccc2C)N2CCCNCC2)cc1OC |
| InChI | InChI=1S/C22H30N2O3/c1-16-8-5-6-9-17(16)22(24-12-7-10-23-11-13-24)18-14-20(26-3)21(27-4)15-19(18)25-2/h5-6,8-9,14-15,22-23H,7,10-13H2,1-4H3 |
| InChIKey | MXVQYKKBTZGDMD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |