C23H28N2O3S — CID 4669160
1-[1-benzothiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 4669160) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[1-benzothiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[1-benzothiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4669160 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[1-benzothiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cc(OC)c(C(c2csc3ccccc23)N2CCCNCC2)cc1OC |
| InChI | InChI=1S/C23H28N2O3S/c1-26-19-14-21(28-3)20(27-2)13-17(19)23(25-11-6-9-24-10-12-25)18-15-29-22-8-5-4-7-16(18)22/h4-5,7-8,13-15,23-24H,6,9-12H2,1-3H3 |
| InChIKey | HSOXTWDSQAEPGL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |