C22H26N2O3S — CID 3935923
1-[1-benzothiophen-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 3935923) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[1-benzothiophen-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[1-benzothiophen-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3935923 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[1-benzothiophen-3-yl-(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(C(c2csc3ccccc23)N2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O3S/c1-25-18-12-15(13-19(26-2)22(18)27-3)21(24-10-8-23-9-11-24)17-14-28-20-7-5-4-6-16(17)20/h4-7,12-14,21,23H,8-11H2,1-3H3 |
| InChIKey | HKSUSROWWAIJMF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |