C17H22N2O2S — CID 3765219
1-[(2,3-dimethoxyphenyl)-thiophen-3-ylmethyl]piperazine (PubChem CID 3765219) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)-thiophen-3-ylmethyl]piperazine.
| Compound Name | 1-[(2,3-dimethoxyphenyl)-thiophen-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 3765219 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)-thiophen-3-ylmethyl]piperazine |
| SMILES | COc1cccc(C(c2ccsc2)N2CCNCC2)c1OC |
| InChI | InChI=1S/C17H22N2O2S/c1-20-15-5-3-4-14(17(15)21-2)16(13-6-11-22-12-13)19-9-7-18-8-10-19/h3-6,11-12,16,18H,7-10H2,1-2H3 |
| InChIKey | WMHDDHDLJSXCLH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |