C14H17BrN2S2 — CID 3668606
1-[(5-bromothiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 3668606) has the molecular formula C14H17BrN2S2 and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(5-bromothiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3668606 |
| Molecular Formula | C14H17BrN2S2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | Brc1ccc(C(c2cccs2)N2CCCNCC2)s1 |
| InChI | InChI=1S/C14H17BrN2S2/c15-13-5-4-12(19-13)14(11-3-1-10-18-11)17-8-2-6-16-7-9-17/h1,3-5,10,14,16H,2,6-9H2 |
| InChIKey | BYGMGZQXZGBJBW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |