C18H23BrN2S — CID 5196811
1-[(5-bromothiophen-2-yl)-(4-propan-2-ylphenyl)methyl]piperazine (PubChem CID 5196811) has the molecular formula C18H23BrN2S and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(4-propan-2-ylphenyl)methyl]piperazine.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(4-propan-2-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 5196811 |
| Molecular Formula | C18H23BrN2S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(4-propan-2-ylphenyl)methyl]piperazine |
| SMILES | CC(C)c1ccc(C(c2ccc(Br)s2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H23BrN2S/c1-13(2)14-3-5-15(6-4-14)18(16-7-8-17(19)22-16)21-11-9-20-10-12-21/h3-8,13,18,20H,9-12H2,1-2H3 |
| InChIKey | YOGGLYDGSIEOTE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |