C13H13BrO3S — CID 61081568
(5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol (PubChem CID 61081568) has the molecular formula C13H13BrO3S and a molecular weight of 329.22 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol.
| Compound Name | (5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61081568 |
| Molecular Formula | C13H13BrO3S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | (5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol |
| SMILES | COc1cccc(OC)c1C(O)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H13BrO3S/c1-16-8-4-3-5-9(17-2)12(8)13(15)10-6-7-11(14)18-10/h3-7,13,15H,1-2H3 |
| InChIKey | ZDGOKDCESSJYLE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |