C13H12Br2O3S — CID 105056992
(4-bromo-2,5-dimethoxyphenyl)-(5-bromothiophen-2-yl)methanol (PubChem CID 105056992) has the molecular formula C13H12Br2O3S and a molecular weight of 408.11 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)-(5-bromothiophen-2-yl)methanol.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)-(5-bromothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 105056992 |
| Molecular Formula | C13H12Br2O3S |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 405.89 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)-(5-bromothiophen-2-yl)methanol |
| SMILES | COc1cc(C(O)c2ccc(Br)s2)c(OC)cc1Br |
| InChI | InChI=1S/C13H12Br2O3S/c1-17-9-6-8(14)10(18-2)5-7(9)13(16)11-3-4-12(15)19-11/h3-6,13,16H,1-2H3 |
| InChIKey | ZIHDLRFGHCROOG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |