C15H13Br2ClO3 — CID 107991354
(2-bromo-4-chlorophenyl)-(4-bromo-2,5-dimethoxyphenyl)methanol (PubChem CID 107991354) has the molecular formula C15H13Br2ClO3 and a molecular weight of 436.53 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl)-(4-bromo-2,5-dimethoxyphenyl)methanol.
| Compound Name | (2-bromo-4-chlorophenyl)-(4-bromo-2,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 107991354 |
| Molecular Formula | C15H13Br2ClO3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | (2-bromo-4-chlorophenyl)-(4-bromo-2,5-dimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)c2ccc(Cl)cc2Br)c(OC)cc1Br |
| InChI | InChI=1S/C15H13Br2ClO3/c1-20-13-7-12(17)14(21-2)6-10(13)15(19)9-4-3-8(18)5-11(9)16/h3-7,15,19H,1-2H3 |
| InChIKey | UDZLNOYJMWHBRO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |