C14H15BrO3S — CID 105057003
(4-bromo-2,5-dimethoxyphenyl)-(4-methylthiophen-3-yl)methanol (PubChem CID 105057003) has the molecular formula C14H15BrO3S and a molecular weight of 343.24 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)-(4-methylthiophen-3-yl)methanol.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)-(4-methylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 105057003 |
| Molecular Formula | C14H15BrO3S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)-(4-methylthiophen-3-yl)methanol |
| SMILES | COc1cc(C(O)c2cscc2C)c(OC)cc1Br |
| InChI | InChI=1S/C14H15BrO3S/c1-8-6-19-7-10(8)14(16)9-4-13(18-3)11(15)5-12(9)17-2/h4-7,14,16H,1-3H3 |
| InChIKey | ICYOUNSRLSMQJC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |