C14H15BrO4S — CID 61081754
(5-bromothiophen-2-yl)-(2,4,5-trimethoxyphenyl)methanol (PubChem CID 61081754) has the molecular formula C14H15BrO4S and a molecular weight of 359.24 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-(2,4,5-trimethoxyphenyl)methanol.
| Compound Name | (5-bromothiophen-2-yl)-(2,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61081754 |
| Molecular Formula | C14H15BrO4S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | (5-bromothiophen-2-yl)-(2,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)c(C(O)c2ccc(Br)s2)cc1OC |
| InChI | InChI=1S/C14H15BrO4S/c1-17-9-7-11(19-3)10(18-2)6-8(9)14(16)12-4-5-13(15)20-12/h4-7,14,16H,1-3H3 |
| InChIKey | PVTJVJVARQTWHZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |