C12H9BrF2O2S — CID 61101677
(5-bromothiophen-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanol (PubChem CID 61101677) has the molecular formula C12H9BrF2O2S and a molecular weight of 335.17 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanol.
| Compound Name | (5-bromothiophen-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 61101677 |
| Molecular Formula | C12H9BrF2O2S |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | (5-bromothiophen-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanol |
| SMILES | COc1cc(F)c(C(O)c2ccc(Br)s2)c(F)c1 |
| InChI | InChI=1S/C12H9BrF2O2S/c1-17-6-4-7(14)11(8(15)5-6)12(16)9-2-3-10(13)18-9/h2-5,12,16H,1H3 |
| InChIKey | KSNYMSWDRVSHPE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |