C12H10F2O3 — CID 61099275
(2,6-difluoro-4-methoxyphenyl)-(furan-3-yl)methanol (PubChem CID 61099275) has the molecular formula C12H10F2O3 and a molecular weight of 240.21 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)-(furan-3-yl)methanol.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 61099275 |
| Molecular Formula | C12H10F2O3 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)-(furan-3-yl)methanol |
| SMILES | COc1cc(F)c(C(O)c2ccoc2)c(F)c1 |
| InChI | InChI=1S/C12H10F2O3/c1-16-8-4-9(13)11(10(14)5-8)12(15)7-2-3-17-6-7/h2-6,12,15H,1H3 |
| InChIKey | HTPTZUWDNLJMSJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |