C11H8F2O2 — CID 95363998
(S)-(3,5-difluorophenyl)-(furan-3-yl)methanol (PubChem CID 95363998) has the molecular formula C11H8F2O2 and a molecular weight of 210.18 g/mol. Its IUPAC name is (S)-(3,5-difluorophenyl)-(furan-3-yl)methanol.
| Compound Name | (S)-(3,5-difluorophenyl)-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 95363998 |
| Molecular Formula | C11H8F2O2 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (S)-(3,5-difluorophenyl)-(furan-3-yl)methanol |
| SMILES | O[C@H](c1ccoc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H8F2O2/c12-9-3-8(4-10(13)5-9)11(14)7-1-2-15-6-7/h1-6,11,14H/t11-/m1/s1 |
| InChIKey | QZCWDUZIYZKZLI-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |