C12H13BrO2S — CID 65153269
(5-bromothiophen-2-yl)-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 65153269) has the molecular formula C12H13BrO2S and a molecular weight of 301.21 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | (5-bromothiophen-2-yl)-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 65153269 |
| Molecular Formula | C12H13BrO2S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | (5-bromothiophen-2-yl)-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | Cc1oc(C)c(C(O)c2ccc(Br)s2)c1C |
| InChI | InChI=1S/C12H13BrO2S/c1-6-7(2)15-8(3)11(6)12(14)9-4-5-10(13)16-9/h4-5,12,14H,1-3H3 |
| InChIKey | BWOYLPYYWPVNNQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |