C12H14O2S — CID 65153315
thiophen-2-yl-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 65153315) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is thiophen-2-yl-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | thiophen-2-yl-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 65153315 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | thiophen-2-yl-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | Cc1oc(C)c(C(O)c2cccs2)c1C |
| InChI | InChI=1S/C12H14O2S/c1-7-8(2)14-9(3)11(7)12(13)10-5-4-6-15-10/h4-6,12-13H,1-3H3 |
| InChIKey | PXSNMEHZDNMLAA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |