About 2-propan-2-ylthiophene
2-propan-2-ylthiophene (PubChem CID 178128598) has the molecular formula C14H20S2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-propan-2-ylthiophene.
Molecular Properties
| Compound Name | 2-propan-2-ylthiophene |
| PubChem CID | 178128598 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-propan-2-ylthiophene |
| SMILES | CC(C)c1cccs1.CC(C)c1cccs1 |
| InChI | InChI=1S/2C7H10S/c2*1-6(2)7-4-3-5-8-7/h2*3-6H,1-2H3 |
| InChIKey | JSFBHQCGPJCHQV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylthiophene?
The IUPAC name of 2-propan-2-ylthiophene (CID 178128598) is 2-propan-2-ylthiophene.
What is the SMILES notation for 2-propan-2-ylthiophene?
The canonical SMILES for 2-propan-2-ylthiophene is CC(C)c1cccs1.CC(C)c1cccs1.
What is the InChIKey of 2-propan-2-ylthiophene?
The InChIKey is JSFBHQCGPJCHQV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10S/c2*1-6(2)7-4-3-5-8-7/h2*3-6H,1-2H3.
What are the key properties of 2-propan-2-ylthiophene?
2-propan-2-ylthiophene has a molecular weight of 252.45 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylthiophene is sourced from PubChem (CID 178128598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).