About ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene
ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene (PubChem CID 170971854) has the molecular formula C17H28OS
and a molecular weight of 280.48 g/mol. Its IUPAC name is ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene.
Molecular Properties
| Compound Name | ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene |
| PubChem CID | 170971854 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene |
| SMILES | CC.CC(C)Cc1ccco1.CC(C)c1cccs1 |
| InChI | InChI=1S/C8H12O.C7H10S.C2H6/c1-7(2)6-8-4-3-5-9-8;1-6(2)7-4-3-5-8-7;1-2/h3-5,7H,6H2,1-2H3;3-6H,1-2H3;1-2H3 |
| InChIKey | CQROIJNRTFZUOU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene?
The IUPAC name of ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene (CID 170971854) is ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene.
What is the SMILES notation for ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene?
The canonical SMILES for ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene is CC.CC(C)Cc1ccco1.CC(C)c1cccs1.
What is the InChIKey of ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene?
The InChIKey is CQROIJNRTFZUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C7H10S.C2H6/c1-7(2)6-8-4-3-5-9-8;1-6(2)7-4-3-5-8-7;1-2/h3-5,7H,6H2,1-2H3;3-6H,1-2H3;1-2H3.
What are the key properties of ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene?
ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene has a molecular weight of 280.48 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methylpropyl)furan;2-propan-2-ylthiophene is sourced from PubChem (CID 170971854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).