C10H10O2S2 — CID 11128014
1,2-dithiophen-2-ylethane-1,2-diol (PubChem CID 11128014) has the molecular formula C10H10O2S2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,2-dithiophen-2-ylethane-1,2-diol.
| Compound Name | 1,2-dithiophen-2-ylethane-1,2-diol |
|---|---|
| PubChem CID | 11128014 |
| Molecular Formula | C10H10O2S2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 1,2-dithiophen-2-ylethane-1,2-diol |
| SMILES | OC(c1cccs1)C(O)c1cccs1 |
| InChI | InChI=1S/C10H10O2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9-12H |
| InChIKey | QYXXNGCUBZQKHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |