C7H9NO3S — CID 6994522
(2R,3S)-2-azaniumyl-3-hydroxy-3-thiophen-2-ylpropanoate (PubChem CID 6994522) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is (2R,3S)-2-azaniumyl-3-hydroxy-3-thiophen-2-ylpropanoate.
| Compound Name | (2R,3S)-2-azaniumyl-3-hydroxy-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 6994522 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | (2R,3S)-2-azaniumyl-3-hydroxy-3-thiophen-2-ylpropanoate |
| SMILES | [NH3+][C@@H](C(=O)[O-])[C@H](O)c1cccs1 |
| InChI | InChI=1S/C7H9NO3S/c8-5(7(10)11)6(9)4-2-1-3-12-4/h1-3,5-6,9H,8H2,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | GNUCLSFLDHLOBV-PHDIDXHHSA-N |
| XLogP | -1.86 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |