C20H14O2S6 — CID 141308355
S-(2,2-dithiophen-2-ylacetyl)sulfanyl 2,2-dithiophen-2-ylethanethioate (PubChem CID 141308355) has the molecular formula C20H14O2S6 and a molecular weight of 478.73 g/mol. Its IUPAC name is S-(2,2-dithiophen-2-ylacetyl)sulfanyl 2,2-dithiophen-2-ylethanethioate.
| Compound Name | S-(2,2-dithiophen-2-ylacetyl)sulfanyl 2,2-dithiophen-2-ylethanethioate |
|---|---|
| PubChem CID | 141308355 |
| Molecular Formula | C20H14O2S6 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 477.93 |
| IUPAC Name | S-(2,2-dithiophen-2-ylacetyl)sulfanyl 2,2-dithiophen-2-ylethanethioate |
| SMILES | O=C(SSC(=O)C(c1cccs1)c1cccs1)C(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H14O2S6/c21-19(17(13-5-1-9-23-13)14-6-2-10-24-14)27-28-20(22)18(15-7-3-11-25-15)16-8-4-12-26-16/h1-12,17-18H |
| InChIKey | HQNQZMDCEKXOAN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|