C7H9N3O2S — CID 54396307
2-(carbamoylamino)-2-thiophen-2-ylacetamide (PubChem CID 54396307) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 2-(carbamoylamino)-2-thiophen-2-ylacetamide.
| Compound Name | 2-(carbamoylamino)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 54396307 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-(carbamoylamino)-2-thiophen-2-ylacetamide |
| SMILES | NC(=O)NC(C(N)=O)c1cccs1 |
| InChI | InChI=1S/C7H9N3O2S/c8-6(11)5(10-7(9)12)4-2-1-3-13-4/h1-3,5H,(H2,8,11)(H3,9,10,12) |
| InChIKey | VALKCLXQMKAWSP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |