C9H13ClN2O3S — CID 119295504
methyl 2-[(2-aminoacetyl)amino]-2-thiophen-2-ylacetate;hydrochloride (PubChem CID 119295504) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is methyl 2-[(2-aminoacetyl)amino]-2-thiophen-2-ylacetate;hydrochloride.
| Compound Name | methyl 2-[(2-aminoacetyl)amino]-2-thiophen-2-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 119295504 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | methyl 2-[(2-aminoacetyl)amino]-2-thiophen-2-ylacetate;hydrochloride |
| SMILES | COC(=O)C(NC(=O)CN)c1cccs1.Cl |
| InChI | InChI=1S/C9H12N2O3S.ClH/c1-14-9(13)8(11-7(12)5-10)6-3-2-4-15-6;/h2-4,8H,5,10H2,1H3,(H,11,12);1H |
| InChIKey | CYNZNTIPXMBAGD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |