C14H20N2O5S — CID 67924715
tert-butyl 2-amino-3-[(2-methoxy-2-oxo-1-thiophen-2-ylethyl)amino]-3-oxopropanoate (PubChem CID 67924715) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[(2-methoxy-2-oxo-1-thiophen-2-ylethyl)amino]-3-oxopropanoate.
| Compound Name | tert-butyl 2-amino-3-[(2-methoxy-2-oxo-1-thiophen-2-ylethyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 67924715 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | tert-butyl 2-amino-3-[(2-methoxy-2-oxo-1-thiophen-2-ylethyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)C(NC(=O)C(N)C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C14H20N2O5S/c1-14(2,3)21-12(18)9(15)11(17)16-10(13(19)20-4)8-6-5-7-22-8/h5-7,9-10H,15H2,1-4H3,(H,16,17) |
| InChIKey | WRXSBRKQZJPGJZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|