C13H19NO4S — CID 19834269
tert-butyl 2-[(2-methoxy-2-oxoethyl)amino]-2-thiophen-2-ylacetate (PubChem CID 19834269) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is tert-butyl 2-[(2-methoxy-2-oxoethyl)amino]-2-thiophen-2-ylacetate.
| Compound Name | tert-butyl 2-[(2-methoxy-2-oxoethyl)amino]-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 19834269 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl 2-[(2-methoxy-2-oxoethyl)amino]-2-thiophen-2-ylacetate |
| SMILES | COC(=O)CNC(C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C13H19NO4S/c1-13(2,3)18-12(16)11(9-6-5-7-19-9)14-8-10(15)17-4/h5-7,11,14H,8H2,1-4H3 |
| InChIKey | IIZLLWNTVVFIIL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |