C13H19NO5 — CID 69345751
methyl 2-(furan-2-yl)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate (PubChem CID 69345751) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2-(furan-2-yl)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate.
| Compound Name | methyl 2-(furan-2-yl)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 69345751 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 2-(furan-2-yl)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate |
| SMILES | COC(=O)C(NCC(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C13H19NO5/c1-13(2,3)19-10(15)8-14-11(12(16)17-4)9-6-5-7-18-9/h5-7,11,14H,8H2,1-4H3 |
| InChIKey | KWDNXNAMZXXGHJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |