C11H14Cl2O3 — CID 70473131
tert-butyl 3,3-dichloro-2-(furan-2-yl)propanoate (PubChem CID 70473131) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is tert-butyl 3,3-dichloro-2-(furan-2-yl)propanoate.
| Compound Name | tert-butyl 3,3-dichloro-2-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 70473131 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | tert-butyl 3,3-dichloro-2-(furan-2-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(c1ccco1)C(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2O3/c1-11(2,3)16-10(14)8(9(12)13)7-5-4-6-15-7/h4-6,8-9H,1-3H3 |
| InChIKey | UQZIRKNWTQBCEC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|