C12H19NO4 — CID 50941092
tert-butyl N-[(1S)-1-(furan-2-yl)-3-hydroxypropyl]carbamate (PubChem CID 50941092) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(furan-2-yl)-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(furan-2-yl)-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 50941092 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl N-[(1S)-1-(furan-2-yl)-3-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)c1ccco1 |
| InChI | InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-9(6-7-14)10-5-4-8-16-10/h4-5,8-9,14H,6-7H2,1-3H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | NNMNZDXZRLVMJN-VIFPVBQESA-N |
| XLogP | 2.23 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |