C15H23NO5 — CID 101373628
tert-butyl N-[(1R,2R)-1-(furan-2-yl)-2-(methoxymethoxy)but-3-enyl]carbamate (PubChem CID 101373628) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(furan-2-yl)-2-(methoxymethoxy)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(furan-2-yl)-2-(methoxymethoxy)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 101373628 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(furan-2-yl)-2-(methoxymethoxy)but-3-enyl]carbamate |
| SMILES | C=C[C@@H](OCOC)[C@@H](NC(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C15H23NO5/c1-6-11(20-10-18-5)13(12-8-7-9-19-12)16-14(17)21-15(2,3)4/h6-9,11,13H,1,10H2,2-5H3,(H,16,17)/t11-,13-/m1/s1 |
| InChIKey | QCYFWPKANCCPCO-DGCLKSJQSA-N |
| XLogP | 3.02 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|