C15H23NO5 — CID 101373626
tert-butyl N-[(4R)-3-(methoxymethoxy)-5-oxoocta-1,6,7-trien-4-yl]carbamate (PubChem CID 101373626) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl N-[(4R)-3-(methoxymethoxy)-5-oxoocta-1,6,7-trien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-3-(methoxymethoxy)-5-oxoocta-1,6,7-trien-4-yl]carbamate |
|---|---|
| PubChem CID | 101373626 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | tert-butyl N-[(4R)-3-(methoxymethoxy)-5-oxoocta-1,6,7-trien-4-yl]carbamate |
| SMILES | C=C=CC(=O)[C@H](NC(=O)OC(C)(C)C)C(C=C)OCOC |
| InChI | InChI=1S/C15H23NO5/c1-7-9-11(17)13(12(8-2)20-10-19-6)16-14(18)21-15(3,4)5/h8-9,12-13H,1-2,10H2,3-6H3,(H,16,18)/t12?,13-/m0/s1 |
| InChIKey | FLPYXIZTQXUUTP-ABLWVSNPSA-N |
| XLogP | 1.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|