C10H19NO4 — CID 10878590
tert-butyl N-[(3S,4S)-4,5-dihydroxypent-1-en-3-yl]carbamate (PubChem CID 10878590) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-4,5-dihydroxypent-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-4,5-dihydroxypent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10878590 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | tert-butyl N-[(3S,4S)-4,5-dihydroxypent-1-en-3-yl]carbamate |
| SMILES | C=C[C@H](NC(=O)OC(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C10H19NO4/c1-5-7(8(13)6-12)11-9(14)15-10(2,3)4/h5,7-8,12-13H,1,6H2,2-4H3,(H,11,14)/t7-,8+/m0/s1 |
| InChIKey | KMUVTHAHRJWHSC-JGVFFNPUSA-N |
| XLogP | 0.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|