C11H21NO4 — CID 86601015
tert-butyl N-(1,3-dihydroxy-3-methylpent-4-en-2-yl)carbamate (PubChem CID 86601015) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is tert-butyl N-(1,3-dihydroxy-3-methylpent-4-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(1,3-dihydroxy-3-methylpent-4-en-2-yl)carbamate |
|---|---|
| PubChem CID | 86601015 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | tert-butyl N-(1,3-dihydroxy-3-methylpent-4-en-2-yl)carbamate |
| SMILES | C=CC(C)(O)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO4/c1-6-11(5,15)8(7-13)12-9(14)16-10(2,3)4/h6,8,13,15H,1,7H2,2-5H3,(H,12,14) |
| InChIKey | FGBQVKKTQYCHPV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|