C12H25NO4 — CID 87529067
tert-butyl N-(3-ethoxy-1-hydroxy-3-methylbutan-2-yl)carbamate (PubChem CID 87529067) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is tert-butyl N-(3-ethoxy-1-hydroxy-3-methylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-ethoxy-1-hydroxy-3-methylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 87529067 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | tert-butyl N-(3-ethoxy-1-hydroxy-3-methylbutan-2-yl)carbamate |
| SMILES | CCOC(C)(C)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO4/c1-7-16-12(5,6)9(8-14)13-10(15)17-11(2,3)4/h9,14H,7-8H2,1-6H3,(H,13,15) |
| InChIKey | CWJCMIMATHWQMS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |