methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate

C8H17NO3 — CID 123513479

IUPACmethyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate
SMILESCOC(=O)NC(CO)C(C)(C)C
InChIInChI=1S/C8H17NO3/c1-8(2,3)6(5-10)9-7(11)12-4/h6,10H,5H2,1-4H3,(H,9,11)
InChIKeyOMXKGOXSTCSGII-UHFFFAOYSA-N
MW175.23 g/mol
LogP0.75
Rot. Bonds2

About methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate

methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate (PubChem CID 123513479) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate.

Molecular Properties

Compound Namemethyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate
PubChem CID123513479
Molecular FormulaC8H17NO3
Molecular Weight175.23 g/mol
Exact Mass175.12
IUPAC Namemethyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate
SMILESCOC(=O)NC(CO)C(C)(C)C
InChIInChI=1S/C8H17NO3/c1-8(2,3)6(5-10)9-7(11)12-4/h6,10H,5H2,1-4H3,(H,9,11)
InChIKeyOMXKGOXSTCSGII-UHFFFAOYSA-N
XLogP0.75
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.23
LogP ≤ 50.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate?
The IUPAC name of methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate (CID 123513479) is methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate.
What is the SMILES notation for methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate?
The canonical SMILES for methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate is COC(=O)NC(CO)C(C)(C)C.
What is the InChIKey of methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate?
The InChIKey is OMXKGOXSTCSGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-8(2,3)6(5-10)9-7(11)12-4/h6,10H,5H2,1-4H3,(H,9,11).
What are the key properties of methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate?
methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate has a molecular weight of 175.23 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1-hydroxy-3,3-dimethylbutan-2-yl)carbamate is sourced from PubChem (CID 123513479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).