C8H16N2O4 — CID 24867821
methyl N-[(2S)-3,3-dimethyl-1-nitrobutan-2-yl]carbamate (PubChem CID 24867821) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl N-[(2S)-3,3-dimethyl-1-nitrobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3,3-dimethyl-1-nitrobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24867821 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | methyl N-[(2S)-3,3-dimethyl-1-nitrobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C8H16N2O4/c1-8(2,3)6(5-10(12)13)9-7(11)14-4/h6H,5H2,1-4H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | ZTAGIXHWUSUEAC-ZCFIWIBFSA-N |
| XLogP | 1.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|