C15H28N2O6 — CID 71546484
ethyl (3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoate (PubChem CID 71546484) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl (3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoate.
| Compound Name | ethyl (3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoate |
|---|---|
| PubChem CID | 71546484 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | ethyl (3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoate |
| SMILES | CCOC(=O)C[C@H](C[N+](=O)[O-])[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H28N2O6/c1-7-22-12(18)8-11(9-17(20)21)13(10(2)3)16-14(19)23-15(4,5)6/h10-11,13H,7-9H2,1-6H3,(H,16,19)/t11-,13+/m1/s1 |
| InChIKey | UXZFZTPBIJFFOO-YPMHNXCESA-N |
| XLogP | 2.38 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|