C23H42N4O9 — CID 71546942
ethyl (3R,4S)-5-methyl-4-[[(3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoyl]amino]-3-(nitromethyl)hexanoate (PubChem CID 71546942) has the molecular formula C23H42N4O9 and a molecular weight of 518.61 g/mol. Its IUPAC name is ethyl (3R,4S)-5-methyl-4-[[(3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoyl]amino]-3-(nitromethyl)hexanoate.
| Compound Name | ethyl (3R,4S)-5-methyl-4-[[(3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoyl]amino]-3-(nitromethyl)hexanoate |
|---|---|
| PubChem CID | 71546942 |
| Molecular Formula | C23H42N4O9 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | ethyl (3R,4S)-5-methyl-4-[[(3R,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)hexanoyl]amino]-3-(nitromethyl)hexanoate |
| SMILES | CCOC(=O)C[C@H](C[N+](=O)[O-])[C@@H](NC(=O)C[C@H](C[N+](=O)[O-])[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C23H42N4O9/c1-9-35-19(29)11-17(13-27(33)34)20(14(2)3)24-18(28)10-16(12-26(31)32)21(15(4)5)25-22(30)36-23(6,7)8/h14-17,20-21H,9-13H2,1-8H3,(H,24,28)(H,25,30)/t16-,17-,20+,21+/m1/s1 |
| InChIKey | LMRGOHOHYDDDGX-JYWFKMLOSA-N |
| XLogP | 2.81 |
| TPSA | 180.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|