C11H24N2O2 — CID 83350039
tert-butyl N-[(3R)-2-amino-4-methylpentan-3-yl]carbamate (PubChem CID 83350039) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl N-[(3R)-2-amino-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-2-amino-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 83350039 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | tert-butyl N-[(3R)-2-amino-4-methylpentan-3-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(C)N |
| InChI | InChI=1S/C11H24N2O2/c1-7(2)9(8(3)12)13-10(14)15-11(4,5)6/h7-9H,12H2,1-6H3,(H,13,14)/t8?,9-/m1/s1 |
| InChIKey | CCDGWMGDQSLCED-YGPZHTELSA-N |
| XLogP | 1.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |