C8H14NO4- — CID 27282404
(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate (PubChem CID 27282404) has the molecular formula C8H14NO4- and a molecular weight of 188.20 g/mol. Its IUPAC name is (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate.
| Compound Name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 27282404 |
| Molecular Formula | C8H14NO4- |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate |
| SMILES | COC(=O)N[C@H](C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)5(6(10)11)9-7(12)13-4/h5H,1-4H3,(H,9,12)(H,10,11)/p-1/t5-/m1/s1 |
| InChIKey | NWPRXAIYBULIEI-RXMQYKEDSA-M |
| XLogP | -0.49 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |