C8H15FN2O3 — CID 123904437
methyl N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 123904437) has the molecular formula C8H15FN2O3 and a molecular weight of 206.22 g/mol. Its IUPAC name is methyl N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123904437 |
| Molecular Formula | C8H15FN2O3 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CNC(=O)C(NC(=O)OC)C(C)(C)F |
| InChI | InChI=1S/C8H15FN2O3/c1-8(2,9)5(6(12)10-3)11-7(13)14-4/h5H,1-4H3,(H,10,12)(H,11,13) |
| InChIKey | YBOVHBBCUBZJCH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |