C7H7F8NO3 — CID 2303347
methyl N-[(1R)-2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl]carbamate (PubChem CID 2303347) has the molecular formula C7H7F8NO3 and a molecular weight of 305.12 g/mol. Its IUPAC name is methyl N-[(1R)-2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl]carbamate.
| Compound Name | methyl N-[(1R)-2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl]carbamate |
|---|---|
| PubChem CID | 2303347 |
| Molecular Formula | C7H7F8NO3 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | methyl N-[(1R)-2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl]carbamate |
| SMILES | COC(=O)N[C@H](O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H7F8NO3/c1-19-4(18)16-3(17)6(12,13)7(14,15)5(10,11)2(8)9/h2-3,17H,1H3,(H,16,18)/t3-/m1/s1 |
| InChIKey | BVMWPTOXORUIIK-GSVOUGTGSA-N |
| XLogP | 1.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|