C13H11F8NO3 — CID 2331475
methyl N-[(1S)-2,2,3,3,4,4,5,5-octafluoro-1-phenoxypentyl]carbamate (PubChem CID 2331475) has the molecular formula C13H11F8NO3 and a molecular weight of 381.22 g/mol. Its IUPAC name is methyl N-[(1S)-2,2,3,3,4,4,5,5-octafluoro-1-phenoxypentyl]carbamate.
| Compound Name | methyl N-[(1S)-2,2,3,3,4,4,5,5-octafluoro-1-phenoxypentyl]carbamate |
|---|---|
| PubChem CID | 2331475 |
| Molecular Formula | C13H11F8NO3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | methyl N-[(1S)-2,2,3,3,4,4,5,5-octafluoro-1-phenoxypentyl]carbamate |
| SMILES | COC(=O)N[C@@H](Oc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H11F8NO3/c1-24-10(23)22-9(25-7-5-3-2-4-6-7)12(18,19)13(20,21)11(16,17)8(14)15/h2-6,8-9H,1H3,(H,22,23)/t9-/m0/s1 |
| InChIKey | LRXXUCICTKQDFM-VIFPVBQESA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|