C25H22F12N2O5 — CID 4654305
[2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-methyl-3-(phenylcarbamoyloxy)propyl] N-phenylcarbamate (PubChem CID 4654305) has the molecular formula C25H22F12N2O5 and a molecular weight of 658.44 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-methyl-3-(phenylcarbamoyloxy)propyl] N-phenylcarbamate.
| Compound Name | [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-methyl-3-(phenylcarbamoyloxy)propyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 4654305 |
| Molecular Formula | C25H22F12N2O5 |
| Molecular Weight | 658.44 g/mol |
| Exact Mass | 658.13 |
| IUPAC Name | [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-methyl-3-(phenylcarbamoyloxy)propyl] N-phenylcarbamate |
| SMILES | CC(COC(=O)Nc1ccccc1)(COC(=O)Nc1ccccc1)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C25H22F12N2O5/c1-20(12-42-18(40)38-15-8-4-2-5-9-15,13-43-19(41)39-16-10-6-3-7-11-16)44-14-21(28,29)23(32,33)25(36,37)24(34,35)22(30,31)17(26)27/h2-11,17H,12-14H2,1H3,(H,38,40)(H,39,41) |
| InChIKey | DFMQZWROPVAMGO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.44 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|