C25H26F24N2O4 — CID 165365508
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl N-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)-2,4,4-trimethylhexyl]carbamate (PubChem CID 165365508) has the molecular formula C25H26F24N2O4 and a molecular weight of 874.44 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl N-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)-2,4,4-trimethylhexyl]carbamate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl N-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)-2,4,4-trimethylhexyl]carbamate |
|---|---|
| PubChem CID | 165365508 |
| Molecular Formula | C25H26F24N2O4 |
| Molecular Weight | 874.44 g/mol |
| Exact Mass | 874.15 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl N-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)-2,4,4-trimethylhexyl]carbamate |
| SMILES | CC(CNC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CC(C)(C)CCNC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C25H26F24N2O4/c1-10(7-51-14(53)55-9-17(32,33)21(40,41)25(48,49)23(44,45)19(36,37)12(28)29)6-15(2,3)4-5-50-13(52)54-8-16(30,31)20(38,39)24(46,47)22(42,43)18(34,35)11(26)27/h10-12H,4-9H2,1-3H3,(H,50,52)(H,51,53) |
| InChIKey | BHYOBBBMGHCRFC-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.44 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|