C16H17F16NO2 — CID 141429901
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl N-hexylcarbamate (PubChem CID 141429901) has the molecular formula C16H17F16NO2 and a molecular weight of 559.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl N-hexylcarbamate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl N-hexylcarbamate |
|---|---|
| PubChem CID | 141429901 |
| Molecular Formula | C16H17F16NO2 |
| Molecular Weight | 559.29 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H17F16NO2/c1-2-3-4-5-6-33-9(34)35-7-10(19,20)12(23,24)14(27,28)16(31,32)15(29,30)13(25,26)11(21,22)8(17)18/h8H,2-7H2,1H3,(H,33,34) |
| InChIKey | CPFCRIDPSMYQAH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.29 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|