C23H34F12N2O4 — CID 154495736
6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)hexyl-(2-ethylhexyl)carbamic acid (PubChem CID 154495736) has the molecular formula C23H34F12N2O4 and a molecular weight of 630.51 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)hexyl-(2-ethylhexyl)carbamic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)hexyl-(2-ethylhexyl)carbamic acid |
|---|---|
| PubChem CID | 154495736 |
| Molecular Formula | C23H34F12N2O4 |
| Molecular Weight | 630.51 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonylamino)hexyl-(2-ethylhexyl)carbamic acid |
| SMILES | CCCCC(CC)CN(CCCCCCNC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C23H34F12N2O4/c1-3-5-10-15(4-2)13-37(18(39)40)12-9-7-6-8-11-36-17(38)41-14-19(26,27)21(30,31)23(34,35)22(32,33)20(28,29)16(24)25/h15-16H,3-14H2,1-2H3,(H,36,38)(H,39,40) |
| InChIKey | JIKJGWOMGOVPSI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.51 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|