C19H28F8O4 — CID 91714187
6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-octyl hexanedioate (PubChem CID 91714187) has the molecular formula C19H28F8O4 and a molecular weight of 472.41 g/mol. Its IUPAC name is 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-octyl hexanedioate.
| Compound Name | 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-octyl hexanedioate |
|---|---|
| PubChem CID | 91714187 |
| Molecular Formula | C19H28F8O4 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-octyl hexanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H28F8O4/c1-2-3-4-5-6-9-12-30-14(28)10-7-8-11-15(29)31-13-17(22,23)19(26,27)18(24,25)16(20)21/h16H,2-13H2,1H3 |
| InChIKey | DCFXMIGVWPCTGF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|