C22H40N2O6 — CID 156874776
2-[[3,3,5-trimethyl-6-[(2-methyl-2-propan-2-yloxypropanoyl)amino]hexyl]carbamoyloxy]ethyl prop-2-enoate (PubChem CID 156874776) has the molecular formula C22H40N2O6 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[[3,3,5-trimethyl-6-[(2-methyl-2-propan-2-yloxypropanoyl)amino]hexyl]carbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[[3,3,5-trimethyl-6-[(2-methyl-2-propan-2-yloxypropanoyl)amino]hexyl]carbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 156874776 |
| Molecular Formula | C22H40N2O6 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-[[3,3,5-trimethyl-6-[(2-methyl-2-propan-2-yloxypropanoyl)amino]hexyl]carbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCC(C)(C)CC(C)CNC(=O)C(C)(C)OC(C)C |
| InChI | InChI=1S/C22H40N2O6/c1-9-18(25)28-12-13-29-20(27)23-11-10-21(5,6)14-17(4)15-24-19(26)22(7,8)30-16(2)3/h9,16-17H,1,10-15H2,2-8H3,(H,23,27)(H,24,26) |
| InChIKey | LPQPUDBYSVUVRK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|