C22H36N2O8 — CID 101153803
2-[[2,4,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 101153803) has the molecular formula C22H36N2O8 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[[2,4,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2,4,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101153803 |
| Molecular Formula | C22H36N2O8 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[[2,4,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC(C)CC(C)(C)CNC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H36N2O8/c1-15(2)18(25)29-8-10-31-20(27)23-13-17(5)12-22(6,7)14-24-21(28)32-11-9-30-19(26)16(3)4/h17H,1,3,8-14H2,2,4-7H3,(H,23,27)(H,24,28) |
| InChIKey | FXIORBJXAMDKDF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|