C35H46N2O14S2 — CID 122677501
2-[[3,5,5-trimethyl-6-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate (PubChem CID 122677501) has the molecular formula C35H46N2O14S2 and a molecular weight of 782.89 g/mol. Its IUPAC name is 2-[[3,5,5-trimethyl-6-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate.
| Compound Name | 2-[[3,5,5-trimethyl-6-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
|---|---|
| PubChem CID | 122677501 |
| Molecular Formula | C35H46N2O14S2 |
| Molecular Weight | 782.89 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | 2-[[3,5,5-trimethyl-6-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOC(=O)NCCC(C)CC(C)(C)CNC(=O)OCCOC(=O)C(=C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H46N2O14S2/c1-24-8-12-29(13-9-24)52(42,43)50-27(4)31(38)46-18-20-48-33(40)36-17-16-26(3)22-35(6,7)23-37-34(41)49-21-19-47-32(39)28(5)51-53(44,45)30-14-10-25(2)11-15-30/h8-15,26H,4-5,16-23H2,1-3,6-7H3,(H,36,40)(H,37,41) |
| InChIKey | MCCDSXMZUWHBJX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|